C22H25F3N4O4 — CID 164590266
2-ethyl-8-hydroxy-5,6-dimethyl-7,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,3,4,5-tetrahydro-1H-pyrido[1,2-b][1,2,5]triazonine-10-carboxamide (PubChem CID 164590266) has the molecular formula C22H25F3N4O4 and a molecular weight of 466.46 g/mol. Its IUPAC name is 2-ethyl-8-hydroxy-5,6-dimethyl-7,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,3,4,5-tetrahydro-1H-pyrido[1,2-b][1,2,5]triazonine-10-carboxamide.
| Compound Name | 2-ethyl-8-hydroxy-5,6-dimethyl-7,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,3,4,5-tetrahydro-1H-pyrido[1,2-b][1,2,5]triazonine-10-carboxamide |
|---|---|
| PubChem CID | 164590266 |
| Molecular Formula | C22H25F3N4O4 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-ethyl-8-hydroxy-5,6-dimethyl-7,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,3,4,5-tetrahydro-1H-pyrido[1,2-b][1,2,5]triazonine-10-carboxamide |
| SMILES | CCC1CCC(C)N(C)C(=O)c2c(O)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn2N1 |
| InChI | InChI=1S/C22H25F3N4O4/c1-4-13-6-5-11(2)28(3)22(33)18-20(31)19(30)15(10-29(18)27-13)21(32)26-9-14-16(24)7-12(23)8-17(14)25/h7-8,10-11,13,27,31H,4-6,9H2,1-3H3,(H,26,32) |
| InChIKey | RAFFVXWSTWJMKU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |