C21H23F3N4O4 — CID 164590445
9-hydroxy-2,7-dimethyl-8,10-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,2,3,4,5,6-hexahydropyrido[1,2-b][1,2,5]triazecine-11-carboxamide (PubChem CID 164590445) has the molecular formula C21H23F3N4O4 and a molecular weight of 452.43 g/mol. Its IUPAC name is 9-hydroxy-2,7-dimethyl-8,10-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,2,3,4,5,6-hexahydropyrido[1,2-b][1,2,5]triazecine-11-carboxamide.
| Compound Name | 9-hydroxy-2,7-dimethyl-8,10-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,2,3,4,5,6-hexahydropyrido[1,2-b][1,2,5]triazecine-11-carboxamide |
|---|---|
| PubChem CID | 164590445 |
| Molecular Formula | C21H23F3N4O4 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 9-hydroxy-2,7-dimethyl-8,10-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-1,2,3,4,5,6-hexahydropyrido[1,2-b][1,2,5]triazecine-11-carboxamide |
| SMILES | CC1CCCCN(C)C(=O)c2c(O)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn2N1 |
| InChI | InChI=1S/C21H23F3N4O4/c1-11-5-3-4-6-27(2)21(32)17-19(30)18(29)14(10-28(17)26-11)20(31)25-9-13-15(23)7-12(22)8-16(13)24/h7-8,10-11,26,30H,3-6,9H2,1-2H3,(H,25,31) |
| InChIKey | XAFOLNZAGKMMLB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |