C19H16F3N3O5 — CID 121422009
(2S,6R)-10-hydroxy-7-methyl-8,11-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-4-oxa-1,7-diazatricyclo[7.4.0.02,6]trideca-9,12-diene-12-carboxamide (PubChem CID 121422009) has the molecular formula C19H16F3N3O5 and a molecular weight of 423.35 g/mol. Its IUPAC name is (2S,6R)-10-hydroxy-7-methyl-8,11-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-4-oxa-1,7-diazatricyclo[7.4.0.02,6]trideca-9,12-diene-12-carboxamide.
| Compound Name | (2S,6R)-10-hydroxy-7-methyl-8,11-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-4-oxa-1,7-diazatricyclo[7.4.0.02,6]trideca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 121422009 |
| Molecular Formula | C19H16F3N3O5 |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | (2S,6R)-10-hydroxy-7-methyl-8,11-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-4-oxa-1,7-diazatricyclo[7.4.0.02,6]trideca-9,12-diene-12-carboxamide |
| SMILES | CN1C(=O)c2c(O)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn2[C@@H]2COC[C@@H]21 |
| InChI | InChI=1S/C19H16F3N3O5/c1-24-13-6-30-7-14(13)25-5-10(16(26)17(27)15(25)19(24)29)18(28)23-4-9-11(21)2-8(20)3-12(9)22/h2-3,5,13-14,27H,4,6-7H2,1H3,(H,23,28)/t13-,14+/m0/s1 |
| InChIKey | CTEYEIDVSISKGY-UONOGXRCSA-N |
| XLogP | 0.93 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |