C22H20F3N3O4 — CID 155145419
(1R,11R,14S)-6-hydroxy-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatetracyclo[7.5.1.111,14.02,7]hexadeca-3,6-diene-4-carboxamide (PubChem CID 155145419) has the molecular formula C22H20F3N3O4 and a molecular weight of 447.41 g/mol. Its IUPAC name is (1R,11R,14S)-6-hydroxy-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatetracyclo[7.5.1.111,14.02,7]hexadeca-3,6-diene-4-carboxamide.
| Compound Name | (1R,11R,14S)-6-hydroxy-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatetracyclo[7.5.1.111,14.02,7]hexadeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 155145419 |
| Molecular Formula | C22H20F3N3O4 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (1R,11R,14S)-6-hydroxy-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatetracyclo[7.5.1.111,14.02,7]hexadeca-3,6-diene-4-carboxamide |
| SMILES | O=C(NCc1c(F)cc(F)cc1F)c1cn2c(c(O)c1=O)C(=O)N1C[C@@H]3CC[C@@H](C3)[C@@H]2C1 |
| InChI | InChI=1S/C22H20F3N3O4/c23-12-4-15(24)13(16(25)5-12)6-26-21(31)14-8-28-17-9-27(7-10-1-2-11(17)3-10)22(32)18(28)20(30)19(14)29/h4-5,8,10-11,17,30H,1-3,6-7,9H2,(H,26,31)/t10-,11+,17+/m1/s1 |
| InChIKey | CPMQIPJYSNCWDA-RLFDGXBXSA-N |
| XLogP | 2.33 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |