C23H24F3N3O4 — CID 155190201
(1R,11R,14S)-N-[(2E,4E)-3,5-difluoro-2-(1-fluoroethenyl)hexa-2,4-dienyl]-6-hydroxy-5,8-dioxo-2,9-diazatetracyclo[7.5.1.111,14.02,7]hexadeca-3,6-diene-4-carboxamide (PubChem CID 155190201) has the molecular formula C23H24F3N3O4 and a molecular weight of 463.46 g/mol. Its IUPAC name is (1R,11R,14S)-N-[(2E,4E)-3,5-difluoro-2-(1-fluoroethenyl)hexa-2,4-dienyl]-6-hydroxy-5,8-dioxo-2,9-diazatetracyclo[7.5.1.111,14.02,7]hexadeca-3,6-diene-4-carboxamide.
| Compound Name | (1R,11R,14S)-N-[(2E,4E)-3,5-difluoro-2-(1-fluoroethenyl)hexa-2,4-dienyl]-6-hydroxy-5,8-dioxo-2,9-diazatetracyclo[7.5.1.111,14.02,7]hexadeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 155190201 |
| Molecular Formula | C23H24F3N3O4 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (1R,11R,14S)-N-[(2E,4E)-3,5-difluoro-2-(1-fluoroethenyl)hexa-2,4-dienyl]-6-hydroxy-5,8-dioxo-2,9-diazatetracyclo[7.5.1.111,14.02,7]hexadeca-3,6-diene-4-carboxamide |
| SMILES | C=C(F)/C(CNC(=O)c1cn2c(c(O)c1=O)C(=O)N1C[C@@H]3CC[C@@H](C3)[C@@H]2C1)=C(F)\C=C(/C)F |
| InChI | InChI=1S/C23H24F3N3O4/c1-11(24)5-17(26)15(12(2)25)7-27-22(32)16-9-29-18-10-28(8-13-3-4-14(18)6-13)23(33)19(29)21(31)20(16)30/h5,9,13-14,18,31H,2-4,6-8,10H2,1H3,(H,27,32)/b11-5+,17-15+/t13-,14+,18+/m1/s1 |
| InChIKey | UYUFKYUMHJOGSL-JJGKOGEOSA-N |
| XLogP | 3.29 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|