C24H26F3N3O6 — CID 169236850
(10S,13R)-6-hydroxy-13-(2-hydroxyethoxymethyl)-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 169236850) has the molecular formula C24H26F3N3O6 and a molecular weight of 509.48 g/mol. Its IUPAC name is (10S,13R)-6-hydroxy-13-(2-hydroxyethoxymethyl)-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | (10S,13R)-6-hydroxy-13-(2-hydroxyethoxymethyl)-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 169236850 |
| Molecular Formula | C24H26F3N3O6 |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | (10S,13R)-6-hydroxy-13-(2-hydroxyethoxymethyl)-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | C[C@H]1CC[C@@H](COCCO)C2CN1C(=O)c1c(O)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn12 |
| InChI | InChI=1S/C24H26F3N3O6/c1-12-2-3-13(11-36-5-4-31)19-10-29(12)24(35)20-22(33)21(32)16(9-30(19)20)23(34)28-8-15-17(26)6-14(25)7-18(15)27/h6-7,9,12-13,19,31,33H,2-5,8,10-11H2,1H3,(H,28,34)/t12-,13-,19?/m0/s1 |
| InChIKey | FWYHSHVJLGXYEZ-LOAJIVSNSA-N |
| XLogP | 1.71 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|