C24H26F2N4O5 — CID 176979413
N-[(2,4-difluorophenyl)methyl]-6-hydroxy-10-methyl-5,8-dioxo-13-(propan-2-ylideneamino)oxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 176979413) has the molecular formula C24H26F2N4O5 and a molecular weight of 488.49 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-6-hydroxy-10-methyl-5,8-dioxo-13-(propan-2-ylideneamino)oxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-6-hydroxy-10-methyl-5,8-dioxo-13-(propan-2-ylideneamino)oxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 176979413 |
| Molecular Formula | C24H26F2N4O5 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-6-hydroxy-10-methyl-5,8-dioxo-13-(propan-2-ylideneamino)oxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | CC(C)=NOC1CCC(C)N2CC1n1cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(O)c1C2=O |
| InChI | InChI=1S/C24H26F2N4O5/c1-12(2)28-35-19-7-4-13(3)29-11-18(19)30-10-16(21(31)22(32)20(30)24(29)34)23(33)27-9-14-5-6-15(25)8-17(14)26/h5-6,8,10,13,18-19,32H,4,7,9,11H2,1-3H3,(H,27,33) |
| InChIKey | JMSSFLOCVUREIG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|