C22H22F3N3O5 — CID 163235254
(1R,10R,13S)-N-[(2,4-difluorophenyl)methyl]-10-(fluoromethyl)-6-hydroxy-13-methoxy-5,8-dioxo-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 163235254) has the molecular formula C22H22F3N3O5 and a molecular weight of 465.43 g/mol. Its IUPAC name is (1R,10R,13S)-N-[(2,4-difluorophenyl)methyl]-10-(fluoromethyl)-6-hydroxy-13-methoxy-5,8-dioxo-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | (1R,10R,13S)-N-[(2,4-difluorophenyl)methyl]-10-(fluoromethyl)-6-hydroxy-13-methoxy-5,8-dioxo-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 163235254 |
| Molecular Formula | C22H22F3N3O5 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (1R,10R,13S)-N-[(2,4-difluorophenyl)methyl]-10-(fluoromethyl)-6-hydroxy-13-methoxy-5,8-dioxo-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | CO[C@H]1CC[C@H](CF)N2C[C@H]1n1cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(O)c1C2=O |
| InChI | InChI=1S/C22H22F3N3O5/c1-33-17-5-4-13(7-23)27-10-16(17)28-9-14(19(29)20(30)18(28)22(27)32)21(31)26-8-11-2-3-12(24)6-15(11)25/h2-3,6,9,13,16-17,30H,4-5,7-8,10H2,1H3,(H,26,31)/t13-,16-,17+/m1/s1 |
| InChIKey | JDNHYGUBWXTJBP-XYPHTWIQSA-N |
| XLogP | 1.91 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |