C27H32F2N4O4 — CID 169025904
3-[(2R)-but-3-en-2-yl]-1-but-3-en-2-yl-5-butoxy-N-[(2,4-difluorophenyl)methyl]-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide (PubChem CID 169025904) has the molecular formula C27H32F2N4O4 and a molecular weight of 514.57 g/mol. Its IUPAC name is 3-[(2R)-but-3-en-2-yl]-1-but-3-en-2-yl-5-butoxy-N-[(2,4-difluorophenyl)methyl]-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide.
| Compound Name | 3-[(2R)-but-3-en-2-yl]-1-but-3-en-2-yl-5-butoxy-N-[(2,4-difluorophenyl)methyl]-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide |
|---|---|
| PubChem CID | 169025904 |
| Molecular Formula | C27H32F2N4O4 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 3-[(2R)-but-3-en-2-yl]-1-but-3-en-2-yl-5-butoxy-N-[(2,4-difluorophenyl)methyl]-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide |
| SMILES | C=CC(C)N1CN([C@H](C)C=C)C(=O)c2c(OCCCC)c(=O)c(C(=O)NCc3ccc(F)cc3F)cn21 |
| InChI | InChI=1S/C27H32F2N4O4/c1-6-9-12-37-25-23-27(36)31(17(4)7-2)16-33(18(5)8-3)32(23)15-21(24(25)34)26(35)30-14-19-10-11-20(28)13-22(19)29/h7-8,10-11,13,15,17-18H,2-3,6,9,12,14,16H2,1,4-5H3,(H,30,35)/t17-,18?/m1/s1 |
| InChIKey | WADODSFHGJCTEO-QNSVNVJESA-N |
| XLogP | 3.74 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|