C32H32F2N4O6 — CID 175462132
but-3-enyl 2-[3-but-3-en-2-yl-7-[(2,4-difluorophenyl)methylcarbamoyl]-4,6-dioxo-5-phenylmethoxy-2H-pyrido[2,1-f][1,2,4]triazin-1-yl]acetate (PubChem CID 175462132) has the molecular formula C32H32F2N4O6 and a molecular weight of 606.63 g/mol. Its IUPAC name is but-3-enyl 2-[3-but-3-en-2-yl-7-[(2,4-difluorophenyl)methylcarbamoyl]-4,6-dioxo-5-phenylmethoxy-2H-pyrido[2,1-f][1,2,4]triazin-1-yl]acetate.
| Compound Name | but-3-enyl 2-[3-but-3-en-2-yl-7-[(2,4-difluorophenyl)methylcarbamoyl]-4,6-dioxo-5-phenylmethoxy-2H-pyrido[2,1-f][1,2,4]triazin-1-yl]acetate |
|---|---|
| PubChem CID | 175462132 |
| Molecular Formula | C32H32F2N4O6 |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | but-3-enyl 2-[3-but-3-en-2-yl-7-[(2,4-difluorophenyl)methylcarbamoyl]-4,6-dioxo-5-phenylmethoxy-2H-pyrido[2,1-f][1,2,4]triazin-1-yl]acetate |
| SMILES | C=CCCOC(=O)CN1CN(C(C)C=C)C(=O)c2c(OCc3ccccc3)c(=O)c(C(=O)NCc3ccc(F)cc3F)cn21 |
| InChI | InChI=1S/C32H32F2N4O6/c1-4-6-14-43-27(39)18-36-20-37(21(3)5-2)32(42)28-30(44-19-22-10-8-7-9-11-22)29(40)25(17-38(28)36)31(41)35-16-23-12-13-24(33)15-26(23)34/h4-5,7-13,15,17,21H,1-2,6,14,16,18-20H2,3H3,(H,35,41) |
| InChIKey | NTLHFJMHRDXSMA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|