C29H31F2N4O7P — CID 145314495
3-[7'-[(2,4-difluorophenyl)methylcarbamoyl]-3'-methyl-4',6'-dioxo-5'-phenylmethoxyspiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-1'-yl]propylphosphonous acid (PubChem CID 145314495) has the molecular formula C29H31F2N4O7P and a molecular weight of 616.56 g/mol. Its IUPAC name is 3-[7'-[(2,4-difluorophenyl)methylcarbamoyl]-3'-methyl-4',6'-dioxo-5'-phenylmethoxyspiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-1'-yl]propylphosphonous acid.
| Compound Name | 3-[7'-[(2,4-difluorophenyl)methylcarbamoyl]-3'-methyl-4',6'-dioxo-5'-phenylmethoxyspiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-1'-yl]propylphosphonous acid |
|---|---|
| PubChem CID | 145314495 |
| Molecular Formula | C29H31F2N4O7P |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 616.19 |
| IUPAC Name | 3-[7'-[(2,4-difluorophenyl)methylcarbamoyl]-3'-methyl-4',6'-dioxo-5'-phenylmethoxyspiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-1'-yl]propylphosphonous acid |
| SMILES | CN1C(=O)c2c(OCc3ccccc3)c(=O)c(C(=O)NCc3ccc(F)cc3F)cn2N(CCCP(O)O)C12CCOC2 |
| InChI | InChI=1S/C29H31F2N4O7P/c1-33-28(38)24-26(42-17-19-6-3-2-4-7-19)25(36)22(27(37)32-15-20-8-9-21(30)14-23(20)31)16-34(24)35(11-5-13-43(39)40)29(33)10-12-41-18-29/h2-4,6-9,14,16,39-40H,5,10-13,15,17-18H2,1H3,(H,32,37) |
| InChIKey | WAOUZTRPBHESGL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 133.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|