C25H31F2N4O8P — CID 140943023
(3S)-1'-(2-diethoxyphosphorylethyl)-N-[(2,4-difluorophenyl)methyl]-5'-hydroxy-3'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide (PubChem CID 140943023) has the molecular formula C25H31F2N4O8P and a molecular weight of 584.51 g/mol. Its IUPAC name is (3S)-1'-(2-diethoxyphosphorylethyl)-N-[(2,4-difluorophenyl)methyl]-5'-hydroxy-3'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide.
| Compound Name | (3S)-1'-(2-diethoxyphosphorylethyl)-N-[(2,4-difluorophenyl)methyl]-5'-hydroxy-3'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide |
|---|---|
| PubChem CID | 140943023 |
| Molecular Formula | C25H31F2N4O8P |
| Molecular Weight | 584.51 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | (3S)-1'-(2-diethoxyphosphorylethyl)-N-[(2,4-difluorophenyl)methyl]-5'-hydroxy-3'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide |
| SMILES | CCOP(=O)(CCN1n2cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(O)c2C(=O)N(C)[C@@]12CCOC2)OCC |
| InChI | InChI=1S/C25H31F2N4O8P/c1-4-38-40(36,39-5-2)11-9-31-25(8-10-37-15-25)29(3)24(35)20-22(33)21(32)18(14-30(20)31)23(34)28-13-16-6-7-17(26)12-19(16)27/h6-7,12,14,33H,4-5,8-11,13,15H2,1-3H3,(H,28,34)/t25-/m0/s1 |
| InChIKey | IIVHLZAVMGVASW-VWLOTQADSA-N |
| XLogP | 2.17 |
| TPSA | 139.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|