C22H25F2N4O8P — CID 140943020
3-[7'-[(2,4-difluorophenyl)methylcarbamoyl]-5'-hydroxy-1'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-3'-yl]propylphosphonic acid (PubChem CID 140943020) has the molecular formula C22H25F2N4O8P and a molecular weight of 542.43 g/mol. Its IUPAC name is 3-[7'-[(2,4-difluorophenyl)methylcarbamoyl]-5'-hydroxy-1'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-3'-yl]propylphosphonic acid.
| Compound Name | 3-[7'-[(2,4-difluorophenyl)methylcarbamoyl]-5'-hydroxy-1'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-3'-yl]propylphosphonic acid |
|---|---|
| PubChem CID | 140943020 |
| Molecular Formula | C22H25F2N4O8P |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | 3-[7'-[(2,4-difluorophenyl)methylcarbamoyl]-5'-hydroxy-1'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-3'-yl]propylphosphonic acid |
| SMILES | CN1n2cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(O)c2C(=O)N(CCCP(=O)(O)O)C12CCOC2 |
| InChI | InChI=1S/C22H25F2N4O8P/c1-26-22(5-7-36-12-22)27(6-2-8-37(33,34)35)21(32)17-19(30)18(29)15(11-28(17)26)20(31)25-10-13-3-4-14(23)9-16(13)24/h3-4,9,11,30H,2,5-8,10,12H2,1H3,(H,25,31)(H2,33,34,35) |
| InChIKey | BIIYZXBJXAVEMY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 161.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|