C15H21N4O8P — CID 167067945
2-[5'-hydroxy-1'-methyl-7'-(methylcarbamoyl)-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-3'-yl]ethylphosphonic acid (PubChem CID 167067945) has the molecular formula C15H21N4O8P and a molecular weight of 416.33 g/mol. Its IUPAC name is 2-[5'-hydroxy-1'-methyl-7'-(methylcarbamoyl)-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-3'-yl]ethylphosphonic acid.
| Compound Name | 2-[5'-hydroxy-1'-methyl-7'-(methylcarbamoyl)-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-3'-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 167067945 |
| Molecular Formula | C15H21N4O8P |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 2-[5'-hydroxy-1'-methyl-7'-(methylcarbamoyl)-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-3'-yl]ethylphosphonic acid |
| SMILES | CNC(=O)c1cn2c(c(O)c1=O)C(=O)N(CCP(=O)(O)O)C1(CCOC1)N2C |
| InChI | InChI=1S/C15H21N4O8P/c1-16-13(22)9-7-19-10(12(21)11(9)20)14(23)18(4-6-28(24,25)26)15(17(19)2)3-5-27-8-15/h7,21H,3-6,8H2,1-2H3,(H,16,22)(H2,24,25,26) |
| InChIKey | BVLFRZODFFSCIK-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 161.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|