C23H26F2N4O6 — CID 118183426
N-[(2,4-difluorophenyl)methyl]-5'-hydroxy-3'-(3-methoxypropyl)-1'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide (PubChem CID 118183426) has the molecular formula C23H26F2N4O6 and a molecular weight of 492.48 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-5'-hydroxy-3'-(3-methoxypropyl)-1'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-5'-hydroxy-3'-(3-methoxypropyl)-1'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide |
|---|---|
| PubChem CID | 118183426 |
| Molecular Formula | C23H26F2N4O6 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-5'-hydroxy-3'-(3-methoxypropyl)-1'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide |
| SMILES | COCCCN1C(=O)c2c(O)c(=O)c(C(=O)NCc3ccc(F)cc3F)cn2N(C)C12CCOC2 |
| InChI | InChI=1S/C23H26F2N4O6/c1-27-23(6-9-35-13-23)28(7-3-8-34-2)22(33)18-20(31)19(30)16(12-29(18)27)21(32)26-11-14-4-5-15(24)10-17(14)25/h4-5,10,12,31H,3,6-9,11,13H2,1-2H3,(H,26,32) |
| InChIKey | GGZXPHUKAVHEEW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|