C27H36FN4O7P — CID 167067863
3'-(3-diethoxyphosphanylpropyl)-N-[(2-fluoro-4-methylphenyl)methyl]-5'-hydroxy-1'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide (PubChem CID 167067863) has the molecular formula C27H36FN4O7P and a molecular weight of 578.58 g/mol. Its IUPAC name is 3'-(3-diethoxyphosphanylpropyl)-N-[(2-fluoro-4-methylphenyl)methyl]-5'-hydroxy-1'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide.
| Compound Name | 3'-(3-diethoxyphosphanylpropyl)-N-[(2-fluoro-4-methylphenyl)methyl]-5'-hydroxy-1'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide |
|---|---|
| PubChem CID | 167067863 |
| Molecular Formula | C27H36FN4O7P |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 3'-(3-diethoxyphosphanylpropyl)-N-[(2-fluoro-4-methylphenyl)methyl]-5'-hydroxy-1'-methyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide |
| SMILES | CCOP(CCCN1C(=O)c2c(O)c(=O)c(C(=O)NCc3ccc(C)cc3F)cn2N(C)C12CCOC2)OCC |
| InChI | InChI=1S/C27H36FN4O7P/c1-5-38-40(39-6-2)13-7-11-31-26(36)22-24(34)23(33)20(16-32(22)30(4)27(31)10-12-37-17-27)25(35)29-15-19-9-8-18(3)14-21(19)28/h8-9,14,16,34H,5-7,10-13,15,17H2,1-4H3,(H,29,35) |
| InChIKey | PVOJCCBZHVWYON-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|