C24H27F2N5O6 — CID 118183422
ethyl 7-[(2,4-difluorophenyl)methylcarbamoyl]-3-ethyl-5-hydroxy-1-methyl-4,6-dioxospiro[pyrido[2,1-f][1,2,4]triazine-2,3'-pyrrolidine]-1'-carboxylate (PubChem CID 118183422) has the molecular formula C24H27F2N5O6 and a molecular weight of 519.51 g/mol. Its IUPAC name is ethyl 7-[(2,4-difluorophenyl)methylcarbamoyl]-3-ethyl-5-hydroxy-1-methyl-4,6-dioxospiro[pyrido[2,1-f][1,2,4]triazine-2,3'-pyrrolidine]-1'-carboxylate.
| Compound Name | ethyl 7-[(2,4-difluorophenyl)methylcarbamoyl]-3-ethyl-5-hydroxy-1-methyl-4,6-dioxospiro[pyrido[2,1-f][1,2,4]triazine-2,3'-pyrrolidine]-1'-carboxylate |
|---|---|
| PubChem CID | 118183422 |
| Molecular Formula | C24H27F2N5O6 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | ethyl 7-[(2,4-difluorophenyl)methylcarbamoyl]-3-ethyl-5-hydroxy-1-methyl-4,6-dioxospiro[pyrido[2,1-f][1,2,4]triazine-2,3'-pyrrolidine]-1'-carboxylate |
| SMILES | CCOC(=O)N1CCC2(C1)N(CC)C(=O)c1c(O)c(=O)c(C(=O)NCc3ccc(F)cc3F)cn1N2C |
| InChI | InChI=1S/C24H27F2N5O6/c1-4-30-22(35)18-20(33)19(32)16(21(34)27-11-14-6-7-15(25)10-17(14)26)12-31(18)28(3)24(30)8-9-29(13-24)23(36)37-5-2/h6-7,10,12,33H,4-5,8-9,11,13H2,1-3H3,(H,27,34) |
| InChIKey | JQSKXUGEZSMVGU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |