C27H35F2N4O6P — CID 158139053
3-[diethoxy(methylidene)-λ5-phosphanyl]-N-[(2,4-difluorophenyl)methyl]-3'-ethyl-5'-hydroxy-1'-methyl-4',6'-dioxospiro[cyclopentane-1,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide (PubChem CID 158139053) has the molecular formula C27H35F2N4O6P and a molecular weight of 580.57 g/mol. Its IUPAC name is 3-[diethoxy(methylidene)-λ5-phosphanyl]-N-[(2,4-difluorophenyl)methyl]-3'-ethyl-5'-hydroxy-1'-methyl-4',6'-dioxospiro[cyclopentane-1,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide.
| Compound Name | 3-[diethoxy(methylidene)-λ5-phosphanyl]-N-[(2,4-difluorophenyl)methyl]-3'-ethyl-5'-hydroxy-1'-methyl-4',6'-dioxospiro[cyclopentane-1,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide |
|---|---|
| PubChem CID | 158139053 |
| Molecular Formula | C27H35F2N4O6P |
| Molecular Weight | 580.57 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | 3-[diethoxy(methylidene)-λ5-phosphanyl]-N-[(2,4-difluorophenyl)methyl]-3'-ethyl-5'-hydroxy-1'-methyl-4',6'-dioxospiro[cyclopentane-1,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide |
| SMILES | C=P(OCC)(OCC)C1CCC2(C1)N(CC)C(=O)c1c(O)c(=O)c(C(=O)NCc3ccc(F)cc3F)cn1N2C |
| InChI | InChI=1S/C27H35F2N4O6P/c1-6-32-26(37)22-24(35)23(34)20(25(36)30-15-17-9-10-18(28)13-21(17)29)16-33(22)31(4)27(32)12-11-19(14-27)40(5,38-7-2)39-8-3/h9-10,13,16,19,35H,5-8,11-12,14-15H2,1-4H3,(H,30,36) |
| InChIKey | FSQIZVFRFRZACJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|