C27H32F2N5O6PS — CID 76902211
3-diethoxyphosphoryl-7'-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-3'-ethyl-5'-hydroxy-1'-methylspiro[cyclopentane-1,2'-pyrido[2,1-f][1,2,4]triazine]-4',6'-dione (PubChem CID 76902211) has the molecular formula C27H32F2N5O6PS and a molecular weight of 623.62 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-7'-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-3'-ethyl-5'-hydroxy-1'-methylspiro[cyclopentane-1,2'-pyrido[2,1-f][1,2,4]triazine]-4',6'-dione.
| Compound Name | 3-diethoxyphosphoryl-7'-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-3'-ethyl-5'-hydroxy-1'-methylspiro[cyclopentane-1,2'-pyrido[2,1-f][1,2,4]triazine]-4',6'-dione |
|---|---|
| PubChem CID | 76902211 |
| Molecular Formula | C27H32F2N5O6PS |
| Molecular Weight | 623.62 g/mol |
| Exact Mass | 623.18 |
| IUPAC Name | 3-diethoxyphosphoryl-7'-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-3'-ethyl-5'-hydroxy-1'-methylspiro[cyclopentane-1,2'-pyrido[2,1-f][1,2,4]triazine]-4',6'-dione |
| SMILES | CCOP(=O)(OCC)C1CCC2(C1)N(CC)C(=O)c1c(O)c(=O)c(-c3nnc(Cc4ccc(F)cc4F)s3)cn1N2C |
| InChI | InChI=1S/C27H32F2N5O6PS/c1-5-33-26(37)22-24(36)23(35)19(25-31-30-21(42-25)12-16-8-9-17(28)13-20(16)29)15-34(22)32(4)27(33)11-10-18(14-27)41(38,39-6-2)40-7-3/h8-9,13,15,18,36H,5-7,10-12,14H2,1-4H3 |
| InChIKey | MMVFSRZTKWNSNK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|