C27H30F2N6O5S — CID 90245328
7'-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-5'-hydroxy-N-(2-methoxyethyl)-1',3'-dimethyl-4',6'-dioxospiro[cyclohexane-4,2'-pyrido[2,1-f][1,2,4]triazine]-1-carboxamide (PubChem CID 90245328) has the molecular formula C27H30F2N6O5S and a molecular weight of 588.64 g/mol. Its IUPAC name is 7'-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-5'-hydroxy-N-(2-methoxyethyl)-1',3'-dimethyl-4',6'-dioxospiro[cyclohexane-4,2'-pyrido[2,1-f][1,2,4]triazine]-1-carboxamide.
| Compound Name | 7'-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-5'-hydroxy-N-(2-methoxyethyl)-1',3'-dimethyl-4',6'-dioxospiro[cyclohexane-4,2'-pyrido[2,1-f][1,2,4]triazine]-1-carboxamide |
|---|---|
| PubChem CID | 90245328 |
| Molecular Formula | C27H30F2N6O5S |
| Molecular Weight | 588.64 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 7'-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-5'-hydroxy-N-(2-methoxyethyl)-1',3'-dimethyl-4',6'-dioxospiro[cyclohexane-4,2'-pyrido[2,1-f][1,2,4]triazine]-1-carboxamide |
| SMILES | COCCNC(=O)C1CCC2(CC1)N(C)C(=O)c1c(O)c(=O)c(-c3nnc(Cc4ccc(F)cc4F)s3)cn1N2C |
| InChI | InChI=1S/C27H30F2N6O5S/c1-33-26(39)21-23(37)22(36)18(25-32-31-20(41-25)12-16-4-5-17(28)13-19(16)29)14-35(21)34(2)27(33)8-6-15(7-9-27)24(38)30-10-11-40-3/h4-5,13-15,37H,6-12H2,1-3H3,(H,30,38) |
| InChIKey | SNGVWSJZKWBGTA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.64 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|