C22H21F2N5O4S — CID 130252532
1-acetyl-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-ethyl-5-hydroxy-2,2-dimethylpyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 130252532) has the molecular formula C22H21F2N5O4S and a molecular weight of 489.50 g/mol. Its IUPAC name is 1-acetyl-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-ethyl-5-hydroxy-2,2-dimethylpyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-acetyl-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-ethyl-5-hydroxy-2,2-dimethylpyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 130252532 |
| Molecular Formula | C22H21F2N5O4S |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 1-acetyl-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-ethyl-5-hydroxy-2,2-dimethylpyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CCN1C(=O)c2c(O)c(=O)c(-c3nnc(Cc4ccc(F)cc4F)s3)cn2N(C(C)=O)C1(C)C |
| InChI | InChI=1S/C22H21F2N5O4S/c1-5-27-21(33)17-19(32)18(31)14(10-28(17)29(11(2)30)22(27,3)4)20-26-25-16(34-20)8-12-6-7-13(23)9-15(12)24/h6-7,9-10,32H,5,8H2,1-4H3 |
| InChIKey | HSWQCZHZXVTUKU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |