C20H20ClFN4O5 — CID 118183459
N-[(3-chloro-4-fluorophenyl)methyl]-5'-hydroxy-1',3'-dimethyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide (PubChem CID 118183459) has the molecular formula C20H20ClFN4O5 and a molecular weight of 450.85 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-5'-hydroxy-1',3'-dimethyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-5'-hydroxy-1',3'-dimethyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide |
|---|---|
| PubChem CID | 118183459 |
| Molecular Formula | C20H20ClFN4O5 |
| Molecular Weight | 450.85 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-5'-hydroxy-1',3'-dimethyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboxamide |
| SMILES | CN1C(=O)c2c(O)c(=O)c(C(=O)NCc3ccc(F)c(Cl)c3)cn2N(C)C12CCOC2 |
| InChI | InChI=1S/C20H20ClFN4O5/c1-24-19(30)15-17(28)16(27)12(9-26(15)25(2)20(24)5-6-31-10-20)18(29)23-8-11-3-4-14(22)13(21)7-11/h3-4,7,9,28H,5-6,8,10H2,1-2H3,(H,23,29) |
| InChIKey | MFABNVVCZLEKJE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.85 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |