C21H22FN5O4S — CID 123529840
[2-(4-fluorophenyl)ethanimidoyl] 5'-hydroxy-1',3'-dimethyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidothioate (PubChem CID 123529840) has the molecular formula C21H22FN5O4S and a molecular weight of 459.50 g/mol. Its IUPAC name is [2-(4-fluorophenyl)ethanimidoyl] 5'-hydroxy-1',3'-dimethyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidothioate.
| Compound Name | [2-(4-fluorophenyl)ethanimidoyl] 5'-hydroxy-1',3'-dimethyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidothioate |
|---|---|
| PubChem CID | 123529840 |
| Molecular Formula | C21H22FN5O4S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | [2-(4-fluorophenyl)ethanimidoyl] 5'-hydroxy-1',3'-dimethyl-4',6'-dioxospiro[oxolane-3,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidothioate |
| SMILES | [H]/N=C(\S/C(Cc1ccc(F)cc1)=N/[H])c1cn2c(c(O)c1=O)C(=O)N(C)C1(CCOC1)N2C |
| InChI | InChI=1S/C21H22FN5O4S/c1-25-20(30)16-18(29)17(28)14(10-27(16)26(2)21(25)7-8-31-11-21)19(24)32-15(23)9-12-3-5-13(22)6-4-12/h3-6,10,23-24,29H,7-9,11H2,1-2H3/b23-15+,24-19- |
| InChIKey | KLUQIWIPMTZXMB-FRQOANLTSA-N |
| XLogP | 1.74 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|