C24H29F2N6O3S+ — CID 144863925
[2-(2,4-difluorophenyl)-1-(5'-hydroxy-1'-methyl-4',6'-dioxo-3'-propylspiro[piperidine-4,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidoyl)sulfanylethylidene]azanium (PubChem CID 144863925) has the molecular formula C24H29F2N6O3S+ and a molecular weight of 519.60 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)-1-(5'-hydroxy-1'-methyl-4',6'-dioxo-3'-propylspiro[piperidine-4,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidoyl)sulfanylethylidene]azanium.
| Compound Name | [2-(2,4-difluorophenyl)-1-(5'-hydroxy-1'-methyl-4',6'-dioxo-3'-propylspiro[piperidine-4,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidoyl)sulfanylethylidene]azanium |
|---|---|
| PubChem CID | 144863925 |
| Molecular Formula | C24H29F2N6O3S+ |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | [2-(2,4-difluorophenyl)-1-(5'-hydroxy-1'-methyl-4',6'-dioxo-3'-propylspiro[piperidine-4,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidoyl)sulfanylethylidene]azanium |
| SMILES | [H]/N=C(\SC(=[NH2+])Cc1ccc(F)cc1F)c1cn2c(c(O)c1=O)C(=O)N(CCC)C1(CCNCC1)N2C |
| InChI | InChI=1S/C24H28F2N6O3S/c1-3-10-31-23(35)19-21(34)20(33)16(13-32(19)30(2)24(31)6-8-29-9-7-24)22(28)36-18(27)11-14-4-5-15(25)12-17(14)26/h4-5,12-13,27-29,34H,3,6-11H2,1-2H3/p+1/b27-18?,28-22- |
| InChIKey | VLEREQGJWHWCMC-TWTQMYCXSA-O |
| XLogP | 0.80 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|