C25H23F2N5O4S — CID 123216432
[2-(2,4-difluorophenyl)ethanimidoyl] 5'-hydroxy-1',3'-dimethyl-4',6'-dioxospiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidothioate (PubChem CID 123216432) has the molecular formula C25H23F2N5O4S and a molecular weight of 527.55 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)ethanimidoyl] 5'-hydroxy-1',3'-dimethyl-4',6'-dioxospiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidothioate.
| Compound Name | [2-(2,4-difluorophenyl)ethanimidoyl] 5'-hydroxy-1',3'-dimethyl-4',6'-dioxospiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidothioate |
|---|---|
| PubChem CID | 123216432 |
| Molecular Formula | C25H23F2N5O4S |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | [2-(2,4-difluorophenyl)ethanimidoyl] 5'-hydroxy-1',3'-dimethyl-4',6'-dioxospiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidothioate |
| SMILES | [H]/N=C(\S/C(Cc1ccc(F)cc1F)=N/[H])c1cn2c(c(O)c1=O)C(=O)N(C)C1(CCCc3occc31)N2C |
| InChI | InChI=1S/C25H23F2N5O4S/c1-30-24(35)20-22(34)21(33)15(23(29)37-19(28)10-13-5-6-14(26)11-17(13)27)12-32(20)31(2)25(30)8-3-4-18-16(25)7-9-36-18/h5-7,9,11-12,28-29,34H,3-4,8,10H2,1-2H3/b28-19+,29-23- |
| InChIKey | FEKFVCMGVDLRIX-XKJPQASQSA-N |
| XLogP | 3.55 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|