C26H34F2N6O5S — CID 144863949
[2-(2,4-difluorophenyl)ethanimidoyl] 6-[ethyl-[1-formyl-4-(methylamino)piperidin-4-yl]carbamoyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboximidothioate;methoxymethane (PubChem CID 144863949) has the molecular formula C26H34F2N6O5S and a molecular weight of 580.66 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)ethanimidoyl] 6-[ethyl-[1-formyl-4-(methylamino)piperidin-4-yl]carbamoyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboximidothioate;methoxymethane.
| Compound Name | [2-(2,4-difluorophenyl)ethanimidoyl] 6-[ethyl-[1-formyl-4-(methylamino)piperidin-4-yl]carbamoyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboximidothioate;methoxymethane |
|---|---|
| PubChem CID | 144863949 |
| Molecular Formula | C26H34F2N6O5S |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | [2-(2,4-difluorophenyl)ethanimidoyl] 6-[ethyl-[1-formyl-4-(methylamino)piperidin-4-yl]carbamoyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboximidothioate;methoxymethane |
| SMILES | COC.[H]/N=C(\S/C(Cc1ccc(F)cc1F)=N/[H])c1c[nH]c(C(=O)N(CC)C2(NC)CCN(C=O)CC2)c(O)c1=O |
| InChI | InChI=1S/C24H28F2N6O4S.C2H6O/c1-3-32(24(29-2)6-8-31(13-33)9-7-24)23(36)19-21(35)20(34)16(12-30-19)22(28)37-18(27)10-14-4-5-15(25)11-17(14)26;1-3-2/h4-5,11-13,27-29,35H,3,6-10H2,1-2H3,(H,30,34);1-2H3/b27-18+,28-22-; |
| InChIKey | MDFHCBGHXLGPLC-WTVHCVMUSA-N |
| XLogP | 2.53 |
| TPSA | 162.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|