C23H25F5N4O5 — CID 144870946
5-N-[(2,4-difluorophenyl)methyl]-3-hydroxy-2-N-methyl-4-oxo-2-N-[3-(4,4,4-trifluorobutylamino)oxolan-3-yl]-1H-pyridine-2,5-dicarboxamide (PubChem CID 144870946) has the molecular formula C23H25F5N4O5 and a molecular weight of 532.47 g/mol. Its IUPAC name is 5-N-[(2,4-difluorophenyl)methyl]-3-hydroxy-2-N-methyl-4-oxo-2-N-[3-(4,4,4-trifluorobutylamino)oxolan-3-yl]-1H-pyridine-2,5-dicarboxamide.
| Compound Name | 5-N-[(2,4-difluorophenyl)methyl]-3-hydroxy-2-N-methyl-4-oxo-2-N-[3-(4,4,4-trifluorobutylamino)oxolan-3-yl]-1H-pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 144870946 |
| Molecular Formula | C23H25F5N4O5 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 5-N-[(2,4-difluorophenyl)methyl]-3-hydroxy-2-N-methyl-4-oxo-2-N-[3-(4,4,4-trifluorobutylamino)oxolan-3-yl]-1H-pyridine-2,5-dicarboxamide |
| SMILES | CN(C(=O)c1[nH]cc(C(=O)NCc2ccc(F)cc2F)c(=O)c1O)C1(NCCCC(F)(F)F)CCOC1 |
| InChI | InChI=1S/C23H25F5N4O5/c1-32(22(6-8-37-12-22)31-7-2-5-23(26,27)28)21(36)17-19(34)18(33)15(11-29-17)20(35)30-10-13-3-4-14(24)9-16(13)25/h3-4,9,11,31,34H,2,5-8,10,12H2,1H3,(H,29,33)(H,30,35) |
| InChIKey | USWPUNSAJLPGJD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|