C23H24F2N2O5 — CID 129259923
N-[(2,4-difluorophenyl)methyl]-1-hydroxy-6,8,8-trimethyl-2,9-dioxospiro[6H-quinolizine-7,2'-oxolane]-3-carboxamide (PubChem CID 129259923) has the molecular formula C23H24F2N2O5 and a molecular weight of 446.45 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-1-hydroxy-6,8,8-trimethyl-2,9-dioxospiro[6H-quinolizine-7,2'-oxolane]-3-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-1-hydroxy-6,8,8-trimethyl-2,9-dioxospiro[6H-quinolizine-7,2'-oxolane]-3-carboxamide |
|---|---|
| PubChem CID | 129259923 |
| Molecular Formula | C23H24F2N2O5 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-1-hydroxy-6,8,8-trimethyl-2,9-dioxospiro[6H-quinolizine-7,2'-oxolane]-3-carboxamide |
| SMILES | CC1n2cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(O)c2C(=O)C(C)(C)C12CCCO2 |
| InChI | InChI=1S/C23H24F2N2O5/c1-12-23(7-4-8-32-23)22(2,3)20(30)17-19(29)18(28)15(11-27(12)17)21(31)26-10-13-5-6-14(24)9-16(13)25/h5-6,9,11-12,29H,4,7-8,10H2,1-3H3,(H,26,31) |
| InChIKey | BURPHEICCOHYSF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |