C21H22F2N2O4 — CID 155273828
(8S)-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-8-methyl-2,9-dioxo-8-propyl-6,7-dihydroquinolizine-3-carboxamide (PubChem CID 155273828) has the molecular formula C21H22F2N2O4 and a molecular weight of 404.41 g/mol. Its IUPAC name is (8S)-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-8-methyl-2,9-dioxo-8-propyl-6,7-dihydroquinolizine-3-carboxamide.
| Compound Name | (8S)-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-8-methyl-2,9-dioxo-8-propyl-6,7-dihydroquinolizine-3-carboxamide |
|---|---|
| PubChem CID | 155273828 |
| Molecular Formula | C21H22F2N2O4 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (8S)-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-8-methyl-2,9-dioxo-8-propyl-6,7-dihydroquinolizine-3-carboxamide |
| SMILES | CCC[C@@]1(C)CCn2cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C21H22F2N2O4/c1-3-6-21(2)7-8-25-11-14(17(26)18(27)16(25)19(21)28)20(29)24-10-12-4-5-13(22)9-15(12)23/h4-5,9,11,27H,3,6-8,10H2,1-2H3,(H,24,29)/t21-/m0/s1 |
| InChIKey | ONVGMQHLKBPNBU-NRFANRHFSA-N |
| XLogP | 3.15 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |