C24H27F2N3O6 — CID 145161135
8-butyl-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-8-methyl-7-(2-nitrosoethoxy)-2,9-dioxo-6,7-dihydroquinolizine-3-carboxamide (PubChem CID 145161135) has the molecular formula C24H27F2N3O6 and a molecular weight of 491.49 g/mol. Its IUPAC name is 8-butyl-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-8-methyl-7-(2-nitrosoethoxy)-2,9-dioxo-6,7-dihydroquinolizine-3-carboxamide.
| Compound Name | 8-butyl-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-8-methyl-7-(2-nitrosoethoxy)-2,9-dioxo-6,7-dihydroquinolizine-3-carboxamide |
|---|---|
| PubChem CID | 145161135 |
| Molecular Formula | C24H27F2N3O6 |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 8-butyl-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-8-methyl-7-(2-nitrosoethoxy)-2,9-dioxo-6,7-dihydroquinolizine-3-carboxamide |
| SMILES | CCCCC1(C)C(=O)c2c(O)c(=O)c(C(=O)NCc3ccc(F)cc3F)cn2CC1OCCN=O |
| InChI | InChI=1S/C24H27F2N3O6/c1-3-4-7-24(2)18(35-9-8-28-34)13-29-12-16(20(30)21(31)19(29)22(24)32)23(33)27-11-14-5-6-15(25)10-17(14)26/h5-6,10,12,18,31H,3-4,7-9,11,13H2,1-2H3,(H,27,33) |
| InChIKey | BDKLVUXKHVDTHB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 127.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|