C23H27F2N2O9P — CID 134271328
2-[[7-[(2,4-difluorophenyl)methylcarbamoyl]-3,9-dimethoxy-2-methyl-1,8-dioxo-3,4-dihydroquinolizin-2-yl]methoxy]ethylphosphonic acid (PubChem CID 134271328) has the molecular formula C23H27F2N2O9P and a molecular weight of 544.44 g/mol. Its IUPAC name is 2-[[7-[(2,4-difluorophenyl)methylcarbamoyl]-3,9-dimethoxy-2-methyl-1,8-dioxo-3,4-dihydroquinolizin-2-yl]methoxy]ethylphosphonic acid.
| Compound Name | 2-[[7-[(2,4-difluorophenyl)methylcarbamoyl]-3,9-dimethoxy-2-methyl-1,8-dioxo-3,4-dihydroquinolizin-2-yl]methoxy]ethylphosphonic acid |
|---|---|
| PubChem CID | 134271328 |
| Molecular Formula | C23H27F2N2O9P |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 2-[[7-[(2,4-difluorophenyl)methylcarbamoyl]-3,9-dimethoxy-2-methyl-1,8-dioxo-3,4-dihydroquinolizin-2-yl]methoxy]ethylphosphonic acid |
| SMILES | COc1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)CC(OC)C(C)(COCCP(=O)(O)O)C2=O |
| InChI | InChI=1S/C23H27F2N2O9P/c1-23(12-36-6-7-37(31,32)33)17(34-2)11-27-10-15(19(28)20(35-3)18(27)21(23)29)22(30)26-9-13-4-5-14(24)8-16(13)25/h4-5,8,10,17H,6-7,9,11-12H2,1-3H3,(H,26,30)(H2,31,32,33) |
| InChIKey | ZFUKMQFRSXUBMQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 153.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|