C24H25F2N3O5 — CID 129167006
(1R,11S,13S,16R)-N-[(2,4-difluorophenyl)methyl]-5-methoxy-14,16-dimethyl-3,6-dioxo-12-oxa-2,9-diazatetracyclo[11.2.1.02,11.04,9]hexadeca-4,7-diene-7-carboxamide (PubChem CID 129167006) has the molecular formula C24H25F2N3O5 and a molecular weight of 473.48 g/mol. Its IUPAC name is (1R,11S,13S,16R)-N-[(2,4-difluorophenyl)methyl]-5-methoxy-14,16-dimethyl-3,6-dioxo-12-oxa-2,9-diazatetracyclo[11.2.1.02,11.04,9]hexadeca-4,7-diene-7-carboxamide.
| Compound Name | (1R,11S,13S,16R)-N-[(2,4-difluorophenyl)methyl]-5-methoxy-14,16-dimethyl-3,6-dioxo-12-oxa-2,9-diazatetracyclo[11.2.1.02,11.04,9]hexadeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 129167006 |
| Molecular Formula | C24H25F2N3O5 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (1R,11S,13S,16R)-N-[(2,4-difluorophenyl)methyl]-5-methoxy-14,16-dimethyl-3,6-dioxo-12-oxa-2,9-diazatetracyclo[11.2.1.02,11.04,9]hexadeca-4,7-diene-7-carboxamide |
| SMILES | COc1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)C[C@@H]1O[C@H]3C(C)C[C@H]([C@H]3C)N1C2=O |
| InChI | InChI=1S/C24H25F2N3O5/c1-11-6-17-12(2)21(11)34-18-10-28-9-15(20(30)22(33-3)19(28)24(32)29(17)18)23(31)27-8-13-4-5-14(25)7-16(13)26/h4-5,7,9,11-12,17-18,21H,6,8,10H2,1-3H3,(H,27,31)/t11?,12-,17-,18+,21+/m1/s1 |
| InChIKey | ZEOBQIQMCTZIGI-PCTNHRMQSA-N |
| XLogP | 2.29 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |