C23H22F2N4O9 — CID 143931343
(2-amino-2-oxoethyl) [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl carbonate (PubChem CID 143931343) has the molecular formula C23H22F2N4O9 and a molecular weight of 536.44 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl carbonate.
| Compound Name | (2-amino-2-oxoethyl) [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl carbonate |
|---|---|
| PubChem CID | 143931343 |
| Molecular Formula | C23H22F2N4O9 |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | (2-amino-2-oxoethyl) [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl carbonate |
| SMILES | CC1COC2Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c(OCOC(=O)OCC(N)=O)c3C(=O)N12 |
| InChI | InChI=1S/C23H22F2N4O9/c1-11-8-35-17-7-28-6-14(21(32)27-5-12-2-3-13(24)4-15(12)25)19(31)20(18(28)22(33)29(11)17)37-10-38-23(34)36-9-16(26)30/h2-4,6,11,17H,5,7-10H2,1H3,(H2,26,30)(H,27,32) |
| InChIKey | FDULQFYFQPWIFO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|