C26H29F2N5O7 — CID 75092528
[12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 4-methylpiperazine-1-carboxylate (PubChem CID 75092528) has the molecular formula C26H29F2N5O7 and a molecular weight of 561.54 g/mol. Its IUPAC name is [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 4-methylpiperazine-1-carboxylate.
| Compound Name | [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 75092528 |
| Molecular Formula | C26H29F2N5O7 |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 4-methylpiperazine-1-carboxylate |
| SMILES | CC1COC2Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c(OCOC(=O)N4CCN(C)CC4)c3C(=O)N12 |
| InChI | InChI=1S/C26H29F2N5O7/c1-15-13-38-20-12-32-11-18(24(35)29-10-16-3-4-17(27)9-19(16)28)22(34)23(21(32)25(36)33(15)20)39-14-40-26(37)31-7-5-30(2)6-8-31/h3-4,9,11,15,20H,5-8,10,12-14H2,1-2H3,(H,29,35) |
| InChIKey | AGDGEPTWGTWFEH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|