C32H27F2N3O5 — CID 66594359
(3R,6S)-6-benzyl-N-[(2,4-difluorophenyl)methyl]-8,11-dioxo-10-phenylmethoxy-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide (PubChem CID 66594359) has the molecular formula C32H27F2N3O5 and a molecular weight of 571.58 g/mol. Its IUPAC name is (3R,6S)-6-benzyl-N-[(2,4-difluorophenyl)methyl]-8,11-dioxo-10-phenylmethoxy-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide.
| Compound Name | (3R,6S)-6-benzyl-N-[(2,4-difluorophenyl)methyl]-8,11-dioxo-10-phenylmethoxy-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 66594359 |
| Molecular Formula | C32H27F2N3O5 |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | (3R,6S)-6-benzyl-N-[(2,4-difluorophenyl)methyl]-8,11-dioxo-10-phenylmethoxy-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N1[C@@H](Cc3ccccc3)CO[C@@H]1C2 |
| InChI | InChI=1S/C32H27F2N3O5/c33-23-12-11-22(26(34)14-23)15-35-31(39)25-16-36-17-27-37(24(19-41-27)13-20-7-3-1-4-8-20)32(40)28(36)30(29(25)38)42-18-21-9-5-2-6-10-21/h1-12,14,16,24,27H,13,15,17-19H2,(H,35,39)/t24-,27+/m0/s1 |
| InChIKey | PODRJBBBEPVWOB-RPLLCQBOSA-N |
| XLogP | 4.06 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |