C25H21F2N3O5 — CID 54713656
(3R,6S)-6-benzyl-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide (PubChem CID 54713656) has the molecular formula C25H21F2N3O5 and a molecular weight of 481.46 g/mol. Its IUPAC name is (3R,6S)-6-benzyl-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide.
| Compound Name | (3R,6S)-6-benzyl-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 54713656 |
| Molecular Formula | C25H21F2N3O5 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (3R,6S)-6-benzyl-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1cn2c(c(O)c1=O)C(=O)N1[C@@H](Cc3ccccc3)CO[C@@H]1C2 |
| InChI | InChI=1S/C25H21F2N3O5/c26-16-7-6-15(19(27)9-16)10-28-24(33)18-11-29-12-20-30(25(34)21(29)23(32)22(18)31)17(13-35-20)8-14-4-2-1-3-5-14/h1-7,9,11,17,20,32H,8,10,12-13H2,(H,28,33)/t17-,20+/m0/s1 |
| InChIKey | OYVUESVXZTUFFS-FXAWDEMLSA-N |
| XLogP | 2.19 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |