C21H21F2N3O7S — CID 138708537
(6S)-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-6-(2-methylsulfonylethyl)-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide (PubChem CID 138708537) has the molecular formula C21H21F2N3O7S and a molecular weight of 497.48 g/mol. Its IUPAC name is (6S)-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-6-(2-methylsulfonylethyl)-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide.
| Compound Name | (6S)-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-6-(2-methylsulfonylethyl)-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 138708537 |
| Molecular Formula | C21H21F2N3O7S |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | (6S)-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-6-(2-methylsulfonylethyl)-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
| SMILES | CS(=O)(=O)CC[C@H]1COC2Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c(O)c3C(=O)N21 |
| InChI | InChI=1S/C21H21F2N3O7S/c1-34(31,32)5-4-13-10-33-16-9-25-8-14(18(27)19(28)17(25)21(30)26(13)16)20(29)24-7-11-2-3-12(22)6-15(11)23/h2-3,6,8,13,16,28H,4-5,7,9-10H2,1H3,(H,24,29)/t13-,16?/m0/s1 |
| InChIKey | NTVNEXPABIPWCQ-KNVGNIICSA-N |
| XLogP | 0.38 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |