C33H29F2N3O6 — CID 67493971
(3R,6S)-N-[(2,4-difluorophenyl)methyl]-8,11-dioxo-10-phenylmethoxy-6-(phenylmethoxymethyl)-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide (PubChem CID 67493971) has the molecular formula C33H29F2N3O6 and a molecular weight of 601.61 g/mol. Its IUPAC name is (3R,6S)-N-[(2,4-difluorophenyl)methyl]-8,11-dioxo-10-phenylmethoxy-6-(phenylmethoxymethyl)-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide.
| Compound Name | (3R,6S)-N-[(2,4-difluorophenyl)methyl]-8,11-dioxo-10-phenylmethoxy-6-(phenylmethoxymethyl)-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 67493971 |
| Molecular Formula | C33H29F2N3O6 |
| Molecular Weight | 601.61 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | (3R,6S)-N-[(2,4-difluorophenyl)methyl]-8,11-dioxo-10-phenylmethoxy-6-(phenylmethoxymethyl)-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N1[C@@H](COCc3ccccc3)CO[C@@H]1C2 |
| InChI | InChI=1S/C33H29F2N3O6/c34-24-12-11-23(27(35)13-24)14-36-32(40)26-15-37-16-28-38(25(20-43-28)19-42-17-21-7-3-1-4-8-21)33(41)29(37)31(30(26)39)44-18-22-9-5-2-6-10-22/h1-13,15,25,28H,14,16-20H2,(H,36,40)/t25-,28+/m0/s1 |
| InChIKey | IAGBLSDJVXRGOU-LBNVMWSVSA-N |
| XLogP | 4.03 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |