C28H29F2N4O4P — CID 143931373
N-[(2,4-difluorophenyl)methyl]-2,5-dioxo-4-phenylmethoxy-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-diene-6-carboxamide;phosphane (PubChem CID 143931373) has the molecular formula C28H29F2N4O4P and a molecular weight of 554.53 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-2,5-dioxo-4-phenylmethoxy-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-diene-6-carboxamide;phosphane.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-2,5-dioxo-4-phenylmethoxy-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-diene-6-carboxamide;phosphane |
|---|---|
| PubChem CID | 143931373 |
| Molecular Formula | C28H29F2N4O4P |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-2,5-dioxo-4-phenylmethoxy-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-diene-6-carboxamide;phosphane |
| SMILES | O=C(NCc1ccc(F)cc1F)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N1CC3CCCN3C1C2.P |
| InChI | InChI=1S/C28H26F2N4O4.H3P/c29-19-9-8-18(22(30)11-19)12-31-27(36)21-14-32-15-23-33-10-4-7-20(33)13-34(23)28(37)24(32)26(25(21)35)38-16-17-5-2-1-3-6-17;/h1-3,5-6,8-9,11,14,20,23H,4,7,10,12-13,15-16H2,(H,31,36);1H3 |
| InChIKey | KEATUTXPQCQQPO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|