C29H25F2N5O9 — CID 67161868
[(10S,15R)-6-[(2,4-difluorophenyl)methylcarbamoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl (4-nitrophenyl) carbonate (PubChem CID 67161868) has the molecular formula C29H25F2N5O9 and a molecular weight of 625.54 g/mol. Its IUPAC name is [(10S,15R)-6-[(2,4-difluorophenyl)methylcarbamoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl (4-nitrophenyl) carbonate.
| Compound Name | [(10S,15R)-6-[(2,4-difluorophenyl)methylcarbamoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 67161868 |
| Molecular Formula | C29H25F2N5O9 |
| Molecular Weight | 625.54 g/mol |
| Exact Mass | 625.16 |
| IUPAC Name | [(10S,15R)-6-[(2,4-difluorophenyl)methylcarbamoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl (4-nitrophenyl) carbonate |
| SMILES | O=C(OCOc1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)C[C@@H]1N(C[C@H]3CCCN31)C2=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H25F2N5O9/c30-17-4-3-16(22(31)10-17)11-32-27(38)21-13-33-14-23-34-9-1-2-19(34)12-35(23)28(39)24(33)26(25(21)37)43-15-44-29(40)45-20-7-5-18(6-8-20)36(41)42/h3-8,10,13,19,23H,1-2,9,11-12,14-15H2,(H,32,38)/t19-,23+/m1/s1 |
| InChIKey | TWRCUGXZKCEUPL-XXBNENTESA-N |
| XLogP | 2.78 |
| TPSA | 162.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|