C25H27F2N5O6 — CID 75577427
[6-[(2,4-difluorophenyl)methylcarbamoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl 2-(methylamino)acetate (PubChem CID 75577427) has the molecular formula C25H27F2N5O6 and a molecular weight of 531.52 g/mol. Its IUPAC name is [6-[(2,4-difluorophenyl)methylcarbamoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl 2-(methylamino)acetate.
| Compound Name | [6-[(2,4-difluorophenyl)methylcarbamoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl 2-(methylamino)acetate |
|---|---|
| PubChem CID | 75577427 |
| Molecular Formula | C25H27F2N5O6 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | [6-[(2,4-difluorophenyl)methylcarbamoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl 2-(methylamino)acetate |
| SMILES | CNCC(=O)OCOc1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)CC1N(CC3CCCN31)C2=O |
| InChI | InChI=1S/C25H27F2N5O6/c1-28-9-20(33)37-13-38-23-21-25(36)32-10-16-3-2-6-31(16)19(32)12-30(21)11-17(22(23)34)24(35)29-8-14-4-5-15(26)7-18(14)27/h4-5,7,11,16,19,28H,2-3,6,8-10,12-13H2,1H3,(H,29,35) |
| InChIKey | JKAHJNQUQJLUCX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|