C25H26F2N4O7 — CID 75078869
[12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl pyrrolidine-1-carboxylate (PubChem CID 75078869) has the molecular formula C25H26F2N4O7 and a molecular weight of 532.50 g/mol. Its IUPAC name is [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl pyrrolidine-1-carboxylate.
| Compound Name | [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 75078869 |
| Molecular Formula | C25H26F2N4O7 |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl pyrrolidine-1-carboxylate |
| SMILES | CC1COC2Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c(OCOC(=O)N4CCCC4)c3C(=O)N12 |
| InChI | InChI=1S/C25H26F2N4O7/c1-14-12-36-19-11-30-10-17(23(33)28-9-15-4-5-16(26)8-18(15)27)21(32)22(20(30)24(34)31(14)19)37-13-38-25(35)29-6-2-3-7-29/h4-5,8,10,14,19H,2-3,6-7,9,11-13H2,1H3,(H,28,33) |
| InChIKey | BPBPWPIILPUJTR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|