C24H26F2N4O8 — CID 91409944
[12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl N-(1-methoxyethyl)carbamate (PubChem CID 91409944) has the molecular formula C24H26F2N4O8 and a molecular weight of 536.49 g/mol. Its IUPAC name is [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl N-(1-methoxyethyl)carbamate.
| Compound Name | [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl N-(1-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 91409944 |
| Molecular Formula | C24H26F2N4O8 |
| Molecular Weight | 536.49 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl N-(1-methoxyethyl)carbamate |
| SMILES | COC(C)NC(=O)OCOc1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)CC1OCC(C)N1C2=O |
| InChI | InChI=1S/C24H26F2N4O8/c1-12-10-36-18-9-29-8-16(22(32)27-7-14-4-5-15(25)6-17(14)26)20(31)21(19(29)23(33)30(12)18)37-11-38-24(34)28-13(2)35-3/h4-6,8,12-13,18H,7,9-11H2,1-3H3,(H,27,32)(H,28,34) |
| InChIKey | UJTZFZOECNBYCX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|