C24H25F2N3O9 — CID 75057935
[12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 3-hydroxypropyl carbonate (PubChem CID 75057935) has the molecular formula C24H25F2N3O9 and a molecular weight of 537.47 g/mol. Its IUPAC name is [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 3-hydroxypropyl carbonate.
| Compound Name | [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 3-hydroxypropyl carbonate |
|---|---|
| PubChem CID | 75057935 |
| Molecular Formula | C24H25F2N3O9 |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | [12-[(2,4-difluorophenyl)methylcarbamoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 3-hydroxypropyl carbonate |
| SMILES | CC1COC2Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c(OCOC(=O)OCCCO)c3C(=O)N12 |
| InChI | InChI=1S/C24H25F2N3O9/c1-13-11-36-18-10-28-9-16(22(32)27-8-14-3-4-15(25)7-17(14)26)20(31)21(19(28)23(33)29(13)18)37-12-38-24(34)35-6-2-5-30/h3-4,7,9,13,18,30H,2,5-6,8,10-12H2,1H3,(H,27,32) |
| InChIKey | PUOSFQKCRSFDHC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|