C31H32F2N4O9 — CID 58366187
[(3R,6S)-12-[3-(2,4-difluorophenyl)propanoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl (6-imidazol-1-yl-2-oxohexyl) carbonate (PubChem CID 58366187) has the molecular formula C31H32F2N4O9 and a molecular weight of 642.61 g/mol. Its IUPAC name is [(3R,6S)-12-[3-(2,4-difluorophenyl)propanoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl (6-imidazol-1-yl-2-oxohexyl) carbonate.
| Compound Name | [(3R,6S)-12-[3-(2,4-difluorophenyl)propanoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl (6-imidazol-1-yl-2-oxohexyl) carbonate |
|---|---|
| PubChem CID | 58366187 |
| Molecular Formula | C31H32F2N4O9 |
| Molecular Weight | 642.61 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | [(3R,6S)-12-[3-(2,4-difluorophenyl)propanoyl]-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl (6-imidazol-1-yl-2-oxohexyl) carbonate |
| SMILES | C[C@H]1CO[C@@H]2Cn3cc(C(=O)CCc4ccc(F)cc4F)c(=O)c(OCOC(=O)OCC(=O)CCCCn4ccnc4)c3C(=O)N12 |
| InChI | InChI=1S/C31H32F2N4O9/c1-19-15-43-26-14-36-13-23(25(39)8-6-20-5-7-21(32)12-24(20)33)28(40)29(27(36)30(41)37(19)26)45-18-46-31(42)44-16-22(38)4-2-3-10-35-11-9-34-17-35/h5,7,9,11-13,17,19,26H,2-4,6,8,10,14-16,18H2,1H3/t19-,26+/m0/s1 |
| InChIKey | GNXSVJNPKXJSEF-AFMDSPMNSA-N |
| XLogP | 3.27 |
| TPSA | 148.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|