C27H27F2N3O8 — CID 58277232
[(10S,15R)-6-[3-(2,4-difluorophenyl)propanoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl 2-oxopropyl carbonate (PubChem CID 58277232) has the molecular formula C27H27F2N3O8 and a molecular weight of 559.52 g/mol. Its IUPAC name is [(10S,15R)-6-[3-(2,4-difluorophenyl)propanoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl 2-oxopropyl carbonate.
| Compound Name | [(10S,15R)-6-[3-(2,4-difluorophenyl)propanoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl 2-oxopropyl carbonate |
|---|---|
| PubChem CID | 58277232 |
| Molecular Formula | C27H27F2N3O8 |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | [(10S,15R)-6-[3-(2,4-difluorophenyl)propanoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl 2-oxopropyl carbonate |
| SMILES | CC(=O)COC(=O)OCOc1c2n(cc(C(=O)CCc3ccc(F)cc3F)c1=O)C[C@@H]1N(C[C@H]3CCCN31)C2=O |
| InChI | InChI=1S/C27H27F2N3O8/c1-15(33)13-38-27(37)40-14-39-25-23-26(36)32-10-18-3-2-8-31(18)22(32)12-30(23)11-19(24(25)35)21(34)7-5-16-4-6-17(28)9-20(16)29/h4,6,9,11,18,22H,2-3,5,7-8,10,12-14H2,1H3/t18-,22+/m1/s1 |
| InChIKey | SKVCPQQVVGWQQR-GCJKJVERSA-N |
| XLogP | 2.28 |
| TPSA | 124.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|