C25H31N3O4 — CID 159232495
ethane;(10R,15S)-4-methoxy-6-(3-phenylpropanoyl)-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-diene-2,5-dione (PubChem CID 159232495) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is ethane;(10R,15S)-4-methoxy-6-(3-phenylpropanoyl)-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-diene-2,5-dione.
| Compound Name | ethane;(10R,15S)-4-methoxy-6-(3-phenylpropanoyl)-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-diene-2,5-dione |
|---|---|
| PubChem CID | 159232495 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | ethane;(10R,15S)-4-methoxy-6-(3-phenylpropanoyl)-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-diene-2,5-dione |
| SMILES | CC.COc1c2n(cc(C(=O)CCc3ccccc3)c1=O)C[C@H]1N(C[C@@H]3CCCN31)C2=O |
| InChI | InChI=1S/C23H25N3O4.C2H6/c1-30-22-20-23(29)26-12-16-8-5-11-25(16)19(26)14-24(20)13-17(21(22)28)18(27)10-9-15-6-3-2-4-7-15;1-2/h2-4,6-7,13,16,19H,5,8-12,14H2,1H3;1-2H3/t16-,19+;/m0./s1 |
| InChIKey | KTBUBNQNNGHREQ-ZKKBRJJYSA-N |
| XLogP | 2.96 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |