C22H25N4O4P — CID 89472933
(10S,15S)-N-benzyl-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,6-diene-6-carboxamide (PubChem CID 89472933) has the molecular formula C22H25N4O4P and a molecular weight of 440.44 g/mol. Its IUPAC name is (10S,15S)-N-benzyl-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,6-diene-6-carboxamide.
| Compound Name | (10S,15S)-N-benzyl-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 89472933 |
| Molecular Formula | C22H25N4O4P |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (10S,15S)-N-benzyl-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,6-diene-6-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cn2c(c(OP)c1=O)C(=O)N1CC[C@@H]3CCCN3[C@@H]1C2 |
| InChI | InChI=1S/C22H25N4O4P/c27-19-16(21(28)23-11-14-5-2-1-3-6-14)12-24-13-17-25-9-4-7-15(25)8-10-26(17)22(29)18(24)20(19)30-31/h1-3,5-6,12,15,17H,4,7-11,13,31H2,(H,23,28)/t15-,17-/m0/s1 |
| InChIKey | HEXPRXFYMTVBOD-RDJZCZTQSA-N |
| XLogP | 1.60 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|