C23H31N4O4P — CID 161232599
(3S,7S)-N-benzyl-4,7-dimethyl-9,12-dioxo-11-phosphanyloxy-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide;ethane (PubChem CID 161232599) has the molecular formula C23H31N4O4P and a molecular weight of 458.50 g/mol. Its IUPAC name is (3S,7S)-N-benzyl-4,7-dimethyl-9,12-dioxo-11-phosphanyloxy-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide;ethane.
| Compound Name | (3S,7S)-N-benzyl-4,7-dimethyl-9,12-dioxo-11-phosphanyloxy-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide;ethane |
|---|---|
| PubChem CID | 161232599 |
| Molecular Formula | C23H31N4O4P |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (3S,7S)-N-benzyl-4,7-dimethyl-9,12-dioxo-11-phosphanyloxy-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide;ethane |
| SMILES | CC.C[C@H]1CCN(C)[C@@H]2Cn3cc(C(=O)NCc4ccccc4)c(=O)c(OP)c3C(=O)N12 |
| InChI | InChI=1S/C21H25N4O4P.C2H6/c1-13-8-9-23(2)16-12-24-11-15(20(27)22-10-14-6-4-3-5-7-14)18(26)19(29-30)17(24)21(28)25(13)16;1-2/h3-7,11,13,16H,8-10,12,30H2,1-2H3,(H,22,27);1-2H3/t13-,16-;/m0./s1 |
| InChIKey | UYYKLGDRXKHOPG-LINSIKMZSA-N |
| XLogP | 2.48 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|