C24H31N4O4P — CID 157171108
(10S,16S)-N-benzyl-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,6-diene-6-carboxamide;ethane (PubChem CID 157171108) has the molecular formula C24H31N4O4P and a molecular weight of 470.51 g/mol. Its IUPAC name is (10S,16S)-N-benzyl-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,6-diene-6-carboxamide;ethane.
| Compound Name | (10S,16S)-N-benzyl-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,6-diene-6-carboxamide;ethane |
|---|---|
| PubChem CID | 157171108 |
| Molecular Formula | C24H31N4O4P |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (10S,16S)-N-benzyl-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,6-diene-6-carboxamide;ethane |
| SMILES | CC.O=C(NCc1ccccc1)c1cn2c(c(OP)c1=O)C(=O)N1C[C@@H]3CCCCN3[C@@H]1C2 |
| InChI | InChI=1S/C22H25N4O4P.C2H6/c27-19-16(21(28)23-10-14-6-2-1-3-7-14)12-24-13-17-25-9-5-4-8-15(25)11-26(17)22(29)18(24)20(19)30-31;1-2/h1-3,6-7,12,15,17H,4-5,8-11,13,31H2,(H,23,28);1-2H3/t15-,17-;/m0./s1 |
| InChIKey | ANLYCOCYRDVCGG-NBLXOJGSSA-N |
| XLogP | 2.62 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|